C18H22O4S — CID 11348217
2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylsulfanylmethyl]cyclohexane-1,3-dione (PubChem CID 11348217) has the molecular formula C18H22O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylsulfanylmethyl]cyclohexane-1,3-dione.
| Compound Name | 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylsulfanylmethyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 11348217 |
| Molecular Formula | C18H22O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylsulfanylmethyl]cyclohexane-1,3-dione |
| SMILES | CC1(C)OC[C@H](C(Sc2ccccc2)C2C(=O)CCCC2=O)O1 |
| InChI | InChI=1S/C18H22O4S/c1-18(2)21-11-15(22-18)17(23-12-7-4-3-5-8-12)16-13(19)9-6-10-14(16)20/h3-5,7-8,15-17H,6,9-11H2,1-2H3/t15-,17?/m1/s1 |
| InChIKey | RWBUSRCRQJQKCN-LDCVWXEPSA-N |
| XLogP | 3.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|