C14H16ClFN2O — CID 113482198
2-(1-chloroethyl)-5-fluoro-1-(3-methyloxolan-3-yl)benzimidazole (PubChem CID 113482198) has the molecular formula C14H16ClFN2O and a molecular weight of 282.75 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-fluoro-1-(3-methyloxolan-3-yl)benzimidazole.
| Compound Name | 2-(1-chloroethyl)-5-fluoro-1-(3-methyloxolan-3-yl)benzimidazole |
|---|---|
| PubChem CID | 113482198 |
| Molecular Formula | C14H16ClFN2O |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-(1-chloroethyl)-5-fluoro-1-(3-methyloxolan-3-yl)benzimidazole |
| SMILES | CC(Cl)c1nc2cc(F)ccc2n1C1(C)CCOC1 |
| InChI | InChI=1S/C14H16ClFN2O/c1-9(15)13-17-11-7-10(16)3-4-12(11)18(13)14(2)5-6-19-8-14/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | CUCGUNSGEUQPLV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|