C10H9BrCl2N4 — CID 113483002
4-bromo-2,6-dichloro-N-[(3-methyltriazol-4-yl)methyl]aniline (PubChem CID 113483002) has the molecular formula C10H9BrCl2N4 and a molecular weight of 336.02 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-[(3-methyltriazol-4-yl)methyl]aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-[(3-methyltriazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 113483002 |
| Molecular Formula | C10H9BrCl2N4 |
| Molecular Weight | 336.02 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-[(3-methyltriazol-4-yl)methyl]aniline |
| SMILES | Cn1nncc1CNc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H9BrCl2N4/c1-17-7(5-15-16-17)4-14-10-8(12)2-6(11)3-9(10)13/h2-3,5,14H,4H2,1H3 |
| InChIKey | UMFKGADGOFFNHH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.02 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |