C12H17Br2N3 — CID 113483310
N-[(3,4-dibromophenyl)methyl]-4-methylpiperazin-1-amine (PubChem CID 113483310) has the molecular formula C12H17Br2N3 and a molecular weight of 363.10 g/mol. Its IUPAC name is N-[(3,4-dibromophenyl)methyl]-4-methylpiperazin-1-amine.
| Compound Name | N-[(3,4-dibromophenyl)methyl]-4-methylpiperazin-1-amine |
|---|---|
| PubChem CID | 113483310 |
| Molecular Formula | C12H17Br2N3 |
| Molecular Weight | 363.10 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | N-[(3,4-dibromophenyl)methyl]-4-methylpiperazin-1-amine |
| SMILES | CN1CCN(NCc2ccc(Br)c(Br)c2)CC1 |
| InChI | InChI=1S/C12H17Br2N3/c1-16-4-6-17(7-5-16)15-9-10-2-3-11(13)12(14)8-10/h2-3,8,15H,4-7,9H2,1H3 |
| InChIKey | PJGOBKROYZWBKQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.10 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |