About 3-pyren-1-ylpropyl methanesulfonate
3-pyren-1-ylpropyl methanesulfonate (PubChem CID 11348336) has the molecular formula C20H18O3S
and a molecular weight of 338.43 g/mol. Its IUPAC name is 3-pyren-1-ylpropyl methanesulfonate.
Molecular Properties
| Compound Name | 3-pyren-1-ylpropyl methanesulfonate |
| PubChem CID | 11348336 |
| Molecular Formula | C20H18O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 3-pyren-1-ylpropyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C20H18O3S/c1-24(21,22)23-13-3-6-14-7-8-17-10-9-15-4-2-5-16-11-12-18(14)20(17)19(15)16/h2,4-5,7-12H,3,6,13H2,1H3 |
| InChIKey | TVWKUSNTWWXXLQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-pyren-1-ylpropyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyren-1-ylpropyl methanesulfonate?
The IUPAC name of 3-pyren-1-ylpropyl methanesulfonate (CID 11348336) is 3-pyren-1-ylpropyl methanesulfonate.
What is the SMILES notation for 3-pyren-1-ylpropyl methanesulfonate?
The canonical SMILES for 3-pyren-1-ylpropyl methanesulfonate is CS(=O)(=O)OCCCc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of 3-pyren-1-ylpropyl methanesulfonate?
The InChIKey is TVWKUSNTWWXXLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O3S/c1-24(21,22)23-13-3-6-14-7-8-17-10-9-15-4-2-5-16-11-12-18(14)20(17)19(15)16/h2,4-5,7-12H,3,6,13H2,1H3.
What are the key properties of 3-pyren-1-ylpropyl methanesulfonate?
3-pyren-1-ylpropyl methanesulfonate has a molecular weight of 338.43 g/mol, XLogP of 4.49, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyren-1-ylpropyl methanesulfonate is sourced from PubChem (CID 11348336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).