C15H24N2 — CID 113483486
2-ethyl-N-[(3-ethyl-2-pyridinyl)methyl]cyclopentan-1-amine (PubChem CID 113483486) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-ethyl-N-[(3-ethyl-2-pyridinyl)methyl]cyclopentan-1-amine.
| Compound Name | 2-ethyl-N-[(3-ethyl-2-pyridinyl)methyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 113483486 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2-ethyl-N-[(3-ethyl-2-pyridinyl)methyl]cyclopentan-1-amine |
| SMILES | CCc1cccnc1CNC1CCCC1CC |
| InChI | InChI=1S/C15H24N2/c1-3-12-7-5-9-14(12)17-11-15-13(4-2)8-6-10-16-15/h6,8,10,12,14,17H,3-5,7,9,11H2,1-2H3 |
| InChIKey | IMLSHUUGNXPRFU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |