C11H10F3N3OS — CID 113483553
1-propyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrazole-4-carbaldehyde (PubChem CID 113483553) has the molecular formula C11H10F3N3OS and a molecular weight of 289.28 g/mol. Its IUPAC name is 1-propyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrazole-4-carbaldehyde.
| Compound Name | 1-propyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 113483553 |
| Molecular Formula | C11H10F3N3OS |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1-propyl-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrazole-4-carbaldehyde |
| SMILES | CCCn1cc(C=O)c(-c2nc(C(F)(F)F)cs2)n1 |
| InChI | InChI=1S/C11H10F3N3OS/c1-2-3-17-4-7(5-18)9(16-17)10-15-8(6-19-10)11(12,13)14/h4-6H,2-3H2,1H3 |
| InChIKey | CXYFHFPYTYJDMP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|