C21H30BNO2 — CID 11348356
(Z)-2-propyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hex-2-enenitrile (PubChem CID 11348356) has the molecular formula C21H30BNO2 and a molecular weight of 339.29 g/mol. Its IUPAC name is (Z)-2-propyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hex-2-enenitrile.
| Compound Name | (Z)-2-propyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hex-2-enenitrile |
|---|---|
| PubChem CID | 11348356 |
| Molecular Formula | C21H30BNO2 |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | (Z)-2-propyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hex-2-enenitrile |
| SMILES | CCC/C(C#N)=C(\CCC)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C21H30BNO2/c1-7-9-17(15-23)19(10-8-2)16-11-13-18(14-12-16)22-24-20(3,4)21(5,6)25-22/h11-14H,7-10H2,1-6H3/b19-17- |
| InChIKey | NGCKDBDVGKIJLB-ZPHPHTNESA-N |
| XLogP | 4.86 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|