C18H34O4Si — CID 11348457
1-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-4,4-dimethylcyclopenten-1-yl]propan-1-one (PubChem CID 11348457) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is 1-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-4,4-dimethylcyclopenten-1-yl]propan-1-one.
| Compound Name | 1-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-4,4-dimethylcyclopenten-1-yl]propan-1-one |
|---|---|
| PubChem CID | 11348457 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-4,4-dimethylcyclopenten-1-yl]propan-1-one |
| SMILES | CCC(=O)C1=C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H]1OCOC |
| InChI | InChI=1S/C18H34O4Si/c1-10-14(19)13-11-15(22-23(8,9)17(2,3)4)18(5,6)16(13)21-12-20-7/h11,15-16H,10,12H2,1-9H3/t15-,16-/m0/s1 |
| InChIKey | XZBADSSSTCOSKL-HOTGVXAUSA-N |
| XLogP | 4.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|