C22H17NO3 — CID 11348474
(3S,4R)-1-oxo-2,3-diphenyl-3,4-dihydroisoquinoline-4-carboxylic acid (PubChem CID 11348474) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is (3S,4R)-1-oxo-2,3-diphenyl-3,4-dihydroisoquinoline-4-carboxylic acid.
| Compound Name | (3S,4R)-1-oxo-2,3-diphenyl-3,4-dihydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 11348474 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (3S,4R)-1-oxo-2,3-diphenyl-3,4-dihydroisoquinoline-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1c2ccccc2C(=O)N(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H17NO3/c24-21-18-14-8-7-13-17(18)19(22(25)26)20(15-9-3-1-4-10-15)23(21)16-11-5-2-6-12-16/h1-14,19-20H,(H,25,26)/t19-,20-/m1/s1 |
| InChIKey | JPBZJHPESNJFRP-WOJBJXKFSA-N |
| XLogP | 4.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |