C20H27NO4 — CID 11348528
1-O-benzyl 2-O-tert-butyl (2S,5R)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 11348528) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-O-benzyl 2-O-tert-butyl (2S,5R)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-tert-butyl (2S,5R)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11348528 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-O-benzyl 2-O-tert-butyl (2S,5R)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CC[C@H]1CC[C@@H](C(=O)OC(C)(C)C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H27NO4/c1-5-9-16-12-13-17(18(22)25-20(2,3)4)21(16)19(23)24-14-15-10-7-6-8-11-15/h5-8,10-11,16-17H,1,9,12-14H2,2-4H3/t16-,17-/m0/s1 |
| InChIKey | PGYOUHLMUKLJFG-IRXDYDNUSA-N |
| XLogP | 4.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|