About 2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate
2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate (PubChem CID 11348567) has the molecular formula C17H31FO4Si
and a molecular weight of 346.52 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate |
| PubChem CID | 11348567 |
| Molecular Formula | C17H31FO4Si |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate |
| SMILES | COC[C@](CCC(C)=C(C)C)(C(=O)F)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C17H31FO4Si/c1-13(2)14(3)8-9-17(12-21-4,15(18)19)16(20)22-10-11-23(5,6)7/h8-12H2,1-7H3/t17-/m1/s1 |
| InChIKey | RUVYHKKXJJTEFV-QGZVFWFLSA-N |
| XLogP | 4.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate?
The IUPAC name of 2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate (CID 11348567) is 2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate.
What is the SMILES notation for 2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate?
The canonical SMILES for 2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate is COC[C@](CCC(C)=C(C)C)(C(=O)F)C(=O)OCC[Si](C)(C)C.
What is the InChIKey of 2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate?
The InChIKey is RUVYHKKXJJTEFV-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H31FO4Si/c1-13(2)14(3)8-9-17(12-21-4,15(18)19)16(20)22-10-11-23(5,6)7/h8-12H2,1-7H3/t17-/m1/s1.
What are the key properties of 2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate?
2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate has a molecular weight of 346.52 g/mol, XLogP of 4.13, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl (2S)-2-carbonofluoridoyl-2-(methoxymethyl)-5,6-dimethylhept-5-enoate is sourced from PubChem (CID 11348567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).