C17H34O5Si — CID 11348569
(3R,5S,6S)-5-methoxy-6-(methoxymethoxy)-3-triethylsilyloxyoct-7-enal (PubChem CID 11348569) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is (3R,5S,6S)-5-methoxy-6-(methoxymethoxy)-3-triethylsilyloxyoct-7-enal.
| Compound Name | (3R,5S,6S)-5-methoxy-6-(methoxymethoxy)-3-triethylsilyloxyoct-7-enal |
|---|---|
| PubChem CID | 11348569 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | (3R,5S,6S)-5-methoxy-6-(methoxymethoxy)-3-triethylsilyloxyoct-7-enal |
| SMILES | C=C[C@H](OCOC)[C@H](C[C@H](CC=O)O[Si](CC)(CC)CC)OC |
| InChI | InChI=1S/C17H34O5Si/c1-7-16(21-14-19-5)17(20-6)13-15(11-12-18)22-23(8-2,9-3)10-4/h7,12,15-17H,1,8-11,13-14H2,2-6H3/t15-,16-,17-/m0/s1 |
| InChIKey | HLDWDJJSVWHXEY-ULQDDVLXSA-N |
| XLogP | 3.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|