C12H17FN2O2S — CID 113486198
3-(aminomethyl)-4-fluoro-5-methyl-N-(1-methylcyclopropyl)benzenesulfonamide (PubChem CID 113486198) has the molecular formula C12H17FN2O2S and a molecular weight of 272.34 g/mol. Its IUPAC name is 3-(aminomethyl)-4-fluoro-5-methyl-N-(1-methylcyclopropyl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-4-fluoro-5-methyl-N-(1-methylcyclopropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113486198 |
| Molecular Formula | C12H17FN2O2S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-(aminomethyl)-4-fluoro-5-methyl-N-(1-methylcyclopropyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2(C)CC2)cc(CN)c1F |
| InChI | InChI=1S/C12H17FN2O2S/c1-8-5-10(6-9(7-14)11(8)13)18(16,17)15-12(2)3-4-12/h5-6,15H,3-4,7,14H2,1-2H3 |
| InChIKey | CTUVXXRTAVKUKY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |