C11H19N3O2S — CID 113486538
3-(1-methylsulfinylpropan-2-ylamino)-1-propylpyrazin-2-one (PubChem CID 113486538) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-(1-methylsulfinylpropan-2-ylamino)-1-propylpyrazin-2-one.
| Compound Name | 3-(1-methylsulfinylpropan-2-ylamino)-1-propylpyrazin-2-one |
|---|---|
| PubChem CID | 113486538 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-(1-methylsulfinylpropan-2-ylamino)-1-propylpyrazin-2-one |
| SMILES | CCCn1ccnc(NC(C)CS(C)=O)c1=O |
| InChI | InChI=1S/C11H19N3O2S/c1-4-6-14-7-5-12-10(11(14)15)13-9(2)8-17(3)16/h5,7,9H,4,6,8H2,1-3H3,(H,12,13) |
| InChIKey | HGMIGSKFUDSTIV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |