C18H29F3O3 — CID 11348675
(1S,2R,3Z,12E,14S)-14-methoxy-2,4-dimethyl-7-(trifluoromethyl)cyclotetradeca-3,12-diene-1,7-diol (PubChem CID 11348675) has the molecular formula C18H29F3O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (1S,2R,3Z,12E,14S)-14-methoxy-2,4-dimethyl-7-(trifluoromethyl)cyclotetradeca-3,12-diene-1,7-diol.
| Compound Name | (1S,2R,3Z,12E,14S)-14-methoxy-2,4-dimethyl-7-(trifluoromethyl)cyclotetradeca-3,12-diene-1,7-diol |
|---|---|
| PubChem CID | 11348675 |
| Molecular Formula | C18H29F3O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1S,2R,3Z,12E,14S)-14-methoxy-2,4-dimethyl-7-(trifluoromethyl)cyclotetradeca-3,12-diene-1,7-diol |
| SMILES | CO[C@H]1/C=C/CCCCC(O)(C(F)(F)F)CC/C(C)=C\[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C18H29F3O3/c1-13-9-11-17(23,18(19,20)21)10-7-5-4-6-8-15(24-3)16(22)14(2)12-13/h6,8,12,14-16,22-23H,4-5,7,9-11H2,1-3H3/b8-6+,13-12-/t14-,15+,16+,17?/m1/s1 |
| InChIKey | PWEGWKVGXZCGDV-APQWFPSZSA-N |
| XLogP | 4.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|