C16H11N5O5 — CID 11348760
2-(4-methoxyphenyl)-6-nitro-5H-[1,2,4]triazolo[4,3-a]quinoxaline-1,4-dione (PubChem CID 11348760) has the molecular formula C16H11N5O5 and a molecular weight of 353.29 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6-nitro-5H-[1,2,4]triazolo[4,3-a]quinoxaline-1,4-dione.
| Compound Name | 2-(4-methoxyphenyl)-6-nitro-5H-[1,2,4]triazolo[4,3-a]quinoxaline-1,4-dione |
|---|---|
| PubChem CID | 11348760 |
| Molecular Formula | C16H11N5O5 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-6-nitro-5H-[1,2,4]triazolo[4,3-a]quinoxaline-1,4-dione |
| SMILES | COc1ccc(-n2nc3c(=O)[nH]c4c([N+](=O)[O-])cccc4n3c2=O)cc1 |
| InChI | InChI=1S/C16H11N5O5/c1-26-10-7-5-9(6-8-10)20-16(23)19-11-3-2-4-12(21(24)25)13(11)17-15(22)14(19)18-20/h2-8H,1H3,(H,17,22) |
| InChIKey | UGJOYDSLQDTUGS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|