C12H20N2O2S2 — CID 113489628
1-(1,4-dithian-2-ylmethyl)-3-ethyl-6-methylpiperazine-2,5-dione (PubChem CID 113489628) has the molecular formula C12H20N2O2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 1-(1,4-dithian-2-ylmethyl)-3-ethyl-6-methylpiperazine-2,5-dione.
| Compound Name | 1-(1,4-dithian-2-ylmethyl)-3-ethyl-6-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 113489628 |
| Molecular Formula | C12H20N2O2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-(1,4-dithian-2-ylmethyl)-3-ethyl-6-methylpiperazine-2,5-dione |
| SMILES | CCC1NC(=O)C(C)N(CC2CSCCS2)C1=O |
| InChI | InChI=1S/C12H20N2O2S2/c1-3-10-12(16)14(8(2)11(15)13-10)6-9-7-17-4-5-18-9/h8-10H,3-7H2,1-2H3,(H,13,15) |
| InChIKey | PKNHXVAFDICRPB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |