C22H38O2Si — CID 11349016
1-[(3aS,9aR,9bS)-9b-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-cyclopenta[a]naphthalen-5-yl]ethanone (PubChem CID 11349016) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is 1-[(3aS,9aR,9bS)-9b-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-cyclopenta[a]naphthalen-5-yl]ethanone.
| Compound Name | 1-[(3aS,9aR,9bS)-9b-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-cyclopenta[a]naphthalen-5-yl]ethanone |
|---|---|
| PubChem CID | 11349016 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 1-[(3aS,9aR,9bS)-9b-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-cyclopenta[a]naphthalen-5-yl]ethanone |
| SMILES | CC(=O)C1=C2CCCC[C@H]2[C@@]2(O[Si](C)(C)C(C)(C)C)CCC[C@@]2(C)C1 |
| InChI | InChI=1S/C22H38O2Si/c1-16(23)18-15-21(5)13-10-14-22(21,19-12-9-8-11-17(18)19)24-25(6,7)20(2,3)4/h19H,8-15H2,1-7H3/t19-,21+,22+/m1/s1 |
| InChIKey | SPCODANHDHEGQQ-HJNYFJLDSA-N |
| XLogP | 6.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|