C14H19FO2 — CID 113490170
1-cyclobutyl-2-(3-fluoro-4-methoxyphenyl)propan-2-ol (PubChem CID 113490170) has the molecular formula C14H19FO2 and a molecular weight of 238.30 g/mol. Its IUPAC name is 1-cyclobutyl-2-(3-fluoro-4-methoxyphenyl)propan-2-ol.
| Compound Name | 1-cyclobutyl-2-(3-fluoro-4-methoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 113490170 |
| Molecular Formula | C14H19FO2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-cyclobutyl-2-(3-fluoro-4-methoxyphenyl)propan-2-ol |
| SMILES | COc1ccc(C(C)(O)CC2CCC2)cc1F |
| InChI | InChI=1S/C14H19FO2/c1-14(16,9-10-4-3-5-10)11-6-7-13(17-2)12(15)8-11/h6-8,10,16H,3-5,9H2,1-2H3 |
| InChIKey | YVFAVSIFBYRKSJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |