C12H22F3NOS — CID 113490412
N-(3-methylsulfinylbutyl)-2-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 113490412) has the molecular formula C12H22F3NOS and a molecular weight of 285.38 g/mol. Its IUPAC name is N-(3-methylsulfinylbutyl)-2-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-(3-methylsulfinylbutyl)-2-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 113490412 |
| Molecular Formula | C12H22F3NOS |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-(3-methylsulfinylbutyl)-2-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CC(CCNC1CCCCC1C(F)(F)F)S(C)=O |
| InChI | InChI=1S/C12H22F3NOS/c1-9(18(2)17)7-8-16-11-6-4-3-5-10(11)12(13,14)15/h9-11,16H,3-8H2,1-2H3 |
| InChIKey | SUQPAZXGAZJDRG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |