About bis[2-(phenylazaniumyl)ethyl]azanium trichloride
bis[2-(phenylazaniumyl)ethyl]azanium trichloride (PubChem CID 11349076) has the molecular formula C16H24Cl3N3
and a molecular weight of 364.75 g/mol. Its IUPAC name is bis[2-(phenylazaniumyl)ethyl]azanium trichloride.
Molecular Properties
| Compound Name | bis[2-(phenylazaniumyl)ethyl]azanium trichloride |
| PubChem CID | 11349076 |
| Molecular Formula | C16H24Cl3N3 |
| Molecular Weight | 364.75 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | bis[2-(phenylazaniumyl)ethyl]azanium trichloride |
| SMILES | [Cl-].[Cl-].[Cl-].c1ccc([NH2+]CC[NH2+]CC[NH2+]c2ccccc2)cc1 |
| InChI | InChI=1S/C16H21N3.3ClH/c1-3-7-15(8-4-1)18-13-11-17-12-14-19-16-9-5-2-6-10-16;;;/h1-10,17-19H,11-14H2;3*1H |
| InChIKey | ALFSRSDLOUOTPK-UHFFFAOYSA-N |
| XLogP | -9.65 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.75 |
| LogP ≤ 5 | -9.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(phenylazaniumyl)ethyl]azanium trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(phenylazaniumyl)ethyl]azanium trichloride?
The IUPAC name of bis[2-(phenylazaniumyl)ethyl]azanium trichloride (CID 11349076) is bis[2-(phenylazaniumyl)ethyl]azanium trichloride.
What is the SMILES notation for bis[2-(phenylazaniumyl)ethyl]azanium trichloride?
The canonical SMILES for bis[2-(phenylazaniumyl)ethyl]azanium trichloride is [Cl-].[Cl-].[Cl-].c1ccc([NH2+]CC[NH2+]CC[NH2+]c2ccccc2)cc1.
What is the InChIKey of bis[2-(phenylazaniumyl)ethyl]azanium trichloride?
The InChIKey is ALFSRSDLOUOTPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3.3ClH/c1-3-7-15(8-4-1)18-13-11-17-12-14-19-16-9-5-2-6-10-16;;;/h1-10,17-19H,11-14H2;3*1H.
What are the key properties of bis[2-(phenylazaniumyl)ethyl]azanium trichloride?
bis[2-(phenylazaniumyl)ethyl]azanium trichloride has a molecular weight of 364.75 g/mol, XLogP of -9.65, 8 rotatable bonds, 3 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(phenylazaniumyl)ethyl]azanium trichloride is sourced from PubChem (CID 11349076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).