C13H17F2NO — CID 113491017
N-[(2,6-difluorophenyl)methyl]-4-methyloxan-4-amine (PubChem CID 113491017) has the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]-4-methyloxan-4-amine.
| Compound Name | N-[(2,6-difluorophenyl)methyl]-4-methyloxan-4-amine |
|---|---|
| PubChem CID | 113491017 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-4-methyloxan-4-amine |
| SMILES | CC1(NCc2c(F)cccc2F)CCOCC1 |
| InChI | InChI=1S/C13H17F2NO/c1-13(5-7-17-8-6-13)16-9-10-11(14)3-2-4-12(10)15/h2-4,16H,5-9H2,1H3 |
| InChIKey | WRSNYKLTMQZWNF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |