C21H38O3Si — CID 11349125
(Z)-6-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]hex-5-enoic acid (PubChem CID 11349125) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is (Z)-6-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]hex-5-enoic acid |
|---|---|
| PubChem CID | 11349125 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (Z)-6-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]hex-5-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC[C@]2(/C=C\CCCC(=O)O)CCC[C@@H]12 |
| InChI | InChI=1S/C21H38O3Si/c1-20(2,3)25(4,5)24-18-12-10-16-21(15-9-11-17(18)21)14-8-6-7-13-19(22)23/h8,14,17-18H,6-7,9-13,15-16H2,1-5H3,(H,22,23)/b14-8-/t17-,18+,21-/m0/s1 |
| InChIKey | OKQNUCYVSFBPCX-ZHOZYJJWSA-N |
| XLogP | 6.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|