C11H18ClN5O2 — CID 113492552
1-[(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]butan-2-ol (PubChem CID 113492552) has the molecular formula C11H18ClN5O2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 1-[(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]butan-2-ol.
| Compound Name | 1-[(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 113492552 |
| Molecular Formula | C11H18ClN5O2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-[(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]butan-2-ol |
| SMILES | CCC(O)CNc1nc(Cl)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H18ClN5O2/c1-2-8(18)7-13-10-14-9(12)15-11(16-10)17-3-5-19-6-4-17/h8,18H,2-7H2,1H3,(H,13,14,15,16) |
| InChIKey | ZMRIAZBGVKBTSJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |