C21H26O6 — CID 11349324
(1S,2S,6S,7S,9R,12R,16R)-4,14-dimethoxy-2,6,13,16-tetramethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-4,13-diene-3,11,15-trione (PubChem CID 11349324) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is (1S,2S,6S,7S,9R,12R,16R)-4,14-dimethoxy-2,6,13,16-tetramethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-4,13-diene-3,11,15-trione.
| Compound Name | (1S,2S,6S,7S,9R,12R,16R)-4,14-dimethoxy-2,6,13,16-tetramethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-4,13-diene-3,11,15-trione |
|---|---|
| PubChem CID | 11349324 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (1S,2S,6S,7S,9R,12R,16R)-4,14-dimethoxy-2,6,13,16-tetramethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-4,13-diene-3,11,15-trione |
| SMILES | COC1=C[C@@H](C)[C@@H]2C[C@H]3OC(=O)[C@H]4C(C)=C(OC)C(=O)[C@H]([C@@]2(C)C1=O)[C@]43C |
| InChI | InChI=1S/C21H26O6/c1-9-7-12(25-5)18(23)20(3)11(9)8-13-21(4)14(19(24)27-13)10(2)16(26-6)15(22)17(20)21/h7,9,11,13-14,17H,8H2,1-6H3/t9-,11+,13-,14-,17-,20+,21+/m1/s1 |
| InChIKey | VLAUFERERFJAAU-PQUVDFDKSA-N |
| XLogP | 2.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |