C22H18FN3O2 — CID 11349348
N-[[2-[(2-fluorophenyl)methyl]-3H-benzimidazol-5-yl]methyl]-4-hydroxybenzamide (PubChem CID 11349348) has the molecular formula C22H18FN3O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is N-[[2-[(2-fluorophenyl)methyl]-3H-benzimidazol-5-yl]methyl]-4-hydroxybenzamide.
| Compound Name | N-[[2-[(2-fluorophenyl)methyl]-3H-benzimidazol-5-yl]methyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 11349348 |
| Molecular Formula | C22H18FN3O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[[2-[(2-fluorophenyl)methyl]-3H-benzimidazol-5-yl]methyl]-4-hydroxybenzamide |
| SMILES | O=C(NCc1ccc2nc(Cc3ccccc3F)[nH]c2c1)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H18FN3O2/c23-18-4-2-1-3-16(18)12-21-25-19-10-5-14(11-20(19)26-21)13-24-22(28)15-6-8-17(27)9-7-15/h1-11,27H,12-13H2,(H,24,28)(H,25,26) |
| InChIKey | YFQJQDVRZQJWNY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |