About tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate
tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 11349430) has the molecular formula C20H27NO4S
and a molecular weight of 377.51 g/mol. Its IUPAC name is tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate |
| PubChem CID | 11349430 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)N(CCC2=CCCC=C2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H27NO4S/c1-16-10-12-18(13-11-16)26(23,24)21(19(22)25-20(2,3)4)15-14-17-8-6-5-7-9-17/h6,8-13H,5,7,14-15H2,1-4H3 |
| InChIKey | XOBUHFIWTYGTEE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate?
The IUPAC name of tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate (CID 11349430) is tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate.
What is the SMILES notation for tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate?
The canonical SMILES for tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate is Cc1ccc(S(=O)(=O)N(CCC2=CCCC=C2)C(=O)OC(C)(C)C)cc1.
What is the InChIKey of tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate?
The InChIKey is XOBUHFIWTYGTEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO4S/c1-16-10-12-18(13-11-16)26(23,24)21(19(22)25-20(2,3)4)15-14-17-8-6-5-7-9-17/h6,8-13H,5,7,14-15H2,1-4H3.
What are the key properties of tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate?
tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate has a molecular weight of 377.51 g/mol, XLogP of 4.59, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-(4-methylphenyl)sulfonylcarbamate is sourced from PubChem (CID 11349430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).