C11H17N3O2S — CID 113496102
1-methyl-3-[(5-propyl-4,5-dihydro-1,3-thiazol-2-yl)amino]pyrrolidine-2,5-dione (PubChem CID 113496102) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 1-methyl-3-[(5-propyl-4,5-dihydro-1,3-thiazol-2-yl)amino]pyrrolidine-2,5-dione.
| Compound Name | 1-methyl-3-[(5-propyl-4,5-dihydro-1,3-thiazol-2-yl)amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 113496102 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-methyl-3-[(5-propyl-4,5-dihydro-1,3-thiazol-2-yl)amino]pyrrolidine-2,5-dione |
| SMILES | CCCC1CN=C(NC2CC(=O)N(C)C2=O)S1 |
| InChI | InChI=1S/C11H17N3O2S/c1-3-4-7-6-12-11(17-7)13-8-5-9(15)14(2)10(8)16/h7-8H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | WOCDOXJRMCEQMB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|