C25H38O3 — CID 11349694
(6E,10E,14E,17S)-17-(furan-3-yl)-17-hydroxy-2,6,10,14-tetramethylheptadeca-6,10,14-trien-4-one (PubChem CID 11349694) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (6E,10E,14E,17S)-17-(furan-3-yl)-17-hydroxy-2,6,10,14-tetramethylheptadeca-6,10,14-trien-4-one.
| Compound Name | (6E,10E,14E,17S)-17-(furan-3-yl)-17-hydroxy-2,6,10,14-tetramethylheptadeca-6,10,14-trien-4-one |
|---|---|
| PubChem CID | 11349694 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (6E,10E,14E,17S)-17-(furan-3-yl)-17-hydroxy-2,6,10,14-tetramethylheptadeca-6,10,14-trien-4-one |
| SMILES | C/C(=C\CC/C(C)=C/C[C@H](O)c1ccoc1)CC/C=C(\C)CC(=O)CC(C)C |
| InChI | InChI=1S/C25H38O3/c1-19(2)16-24(26)17-22(5)11-7-9-20(3)8-6-10-21(4)12-13-25(27)23-14-15-28-18-23/h8,11-12,14-15,18-19,25,27H,6-7,9-10,13,16-17H2,1-5H3/b20-8+,21-12+,22-11+/t25-/m0/s1 |
| InChIKey | UZXKOVIRYVHQGU-PGMCJAAPSA-N |
| XLogP | 7.11 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|