About 3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide
3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide (PubChem CID 113497133) has the molecular formula C14H28N2O
and a molecular weight of 240.39 g/mol. Its IUPAC name is 3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide.
Molecular Properties
| Compound Name | 3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide |
| PubChem CID | 113497133 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide |
| SMILES | CCC1(NC(=O)CC(N)CC(C)(C)C)CCC1 |
| InChI | InChI=1S/C14H28N2O/c1-5-14(7-6-8-14)16-12(17)9-11(15)10-13(2,3)4/h11H,5-10,15H2,1-4H3,(H,16,17) |
| InChIKey | BENQOHXTXHEGEP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide?
The IUPAC name of 3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide (CID 113497133) is 3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide.
What is the SMILES notation for 3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide?
The canonical SMILES for 3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide is CCC1(NC(=O)CC(N)CC(C)(C)C)CCC1.
What is the InChIKey of 3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide?
The InChIKey is BENQOHXTXHEGEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O/c1-5-14(7-6-8-14)16-12(17)9-11(15)10-13(2,3)4/h11H,5-10,15H2,1-4H3,(H,16,17).
What are the key properties of 3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide?
3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide has a molecular weight of 240.39 g/mol, XLogP of 2.59, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(1-ethylcyclobutyl)-5,5-dimethylhexanamide is sourced from PubChem (CID 113497133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).