C21H25NO4S — CID 11349724
(3aR,4R,6aS)-4-(benzenesulfonylmethyl)-5-benzyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 11349724) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is (3aR,4R,6aS)-4-(benzenesulfonylmethyl)-5-benzyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole.
| Compound Name | (3aR,4R,6aS)-4-(benzenesulfonylmethyl)-5-benzyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 11349724 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (3aR,4R,6aS)-4-(benzenesulfonylmethyl)-5-benzyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | CC1(C)O[C@H]2[C@H](CN(Cc3ccccc3)[C@H]2CS(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C21H25NO4S/c1-21(2)25-19-14-22(13-16-9-5-3-6-10-16)18(20(19)26-21)15-27(23,24)17-11-7-4-8-12-17/h3-12,18-20H,13-15H2,1-2H3/t18-,19-,20+/m0/s1 |
| InChIKey | HIROCLZMDUAMNE-SLFFLAALSA-N |
| XLogP | 2.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |