C10H6ClF3N2O2S — CID 113497443
2-(chloromethyl)-5-[2-(trifluoromethoxy)phenoxy]-1,3,4-thiadiazole (PubChem CID 113497443) has the molecular formula C10H6ClF3N2O2S and a molecular weight of 310.68 g/mol. Its IUPAC name is 2-(chloromethyl)-5-[2-(trifluoromethoxy)phenoxy]-1,3,4-thiadiazole.
| Compound Name | 2-(chloromethyl)-5-[2-(trifluoromethoxy)phenoxy]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 113497443 |
| Molecular Formula | C10H6ClF3N2O2S |
| Molecular Weight | 310.68 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 2-(chloromethyl)-5-[2-(trifluoromethoxy)phenoxy]-1,3,4-thiadiazole |
| SMILES | FC(F)(F)Oc1ccccc1Oc1nnc(CCl)s1 |
| InChI | InChI=1S/C10H6ClF3N2O2S/c11-5-8-15-16-9(19-8)17-6-3-1-2-4-7(6)18-10(12,13)14/h1-4H,5H2 |
| InChIKey | KGRAQCBTJXVDTO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.68 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|