C19H13F3N2O2S — CID 11349802
2-[3-[2-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)ethyl]indol-1-yl]acetic acid (PubChem CID 11349802) has the molecular formula C19H13F3N2O2S and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-[3-[2-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)ethyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[2-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)ethyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 11349802 |
| Molecular Formula | C19H13F3N2O2S |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 2-[3-[2-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)ethyl]indol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CCc2nc3c(F)c(F)cc(F)c3s2)c2ccccc21 |
| InChI | InChI=1S/C19H13F3N2O2S/c20-12-7-13(21)19-18(17(12)22)23-15(27-19)6-5-10-8-24(9-16(25)26)14-4-2-1-3-11(10)14/h1-4,7-8H,5-6,9H2,(H,25,26) |
| InChIKey | VDZUYWMVYLIKHW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|