About 1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea
1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea (PubChem CID 11349808) has the molecular formula C20H18N6O3
and a molecular weight of 390.40 g/mol. Its IUPAC name is 1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea.
Molecular Properties
| Compound Name | 1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea |
| PubChem CID | 11349808 |
| Molecular Formula | C20H18N6O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2c(-n3cccn3)cc(-c3ccc4c(c3)OCO4)cc2[nH]1 |
| InChI | InChI=1S/C20H18N6O3/c1-2-21-20(27)25-19-23-14-8-13(12-4-5-16-17(10-12)29-11-28-16)9-15(18(14)24-19)26-7-3-6-22-26/h3-10H,2,11H2,1H3,(H3,21,23,24,25,27) |
| InChIKey | LDQKDCFQGZNPHV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea?
The IUPAC name of 1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea (CID 11349808) is 1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea.
What is the SMILES notation for 1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea?
The canonical SMILES for 1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea is CCNC(=O)Nc1nc2c(-n3cccn3)cc(-c3ccc4c(c3)OCO4)cc2[nH]1.
What is the InChIKey of 1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea?
The InChIKey is LDQKDCFQGZNPHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N6O3/c1-2-21-20(27)25-19-23-14-8-13(12-4-5-16-17(10-12)29-11-28-16)9-15(18(14)24-19)26-7-3-6-22-26/h3-10H,2,11H2,1H3,(H3,21,23,24,25,27).
What are the key properties of 1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea?
1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea has a molecular weight of 390.40 g/mol, XLogP of 3.29, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(1,3-benzodioxol-5-yl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]-3-ethylurea is sourced from PubChem (CID 11349808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).