C10H16N6O — CID 113498110
6-(3-aminopentylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 113498110) has the molecular formula C10H16N6O and a molecular weight of 236.28 g/mol. Its IUPAC name is 6-(3-aminopentylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-(3-aminopentylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 113498110 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 6-(3-aminopentylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | CCC(N)CCNc1ccc2n[nH]c(=O)n2n1 |
| InChI | InChI=1S/C10H16N6O/c1-2-7(11)5-6-12-8-3-4-9-13-14-10(17)16(9)15-8/h3-4,7H,2,5-6,11H2,1H3,(H,12,15)(H,14,17) |
| InChIKey | MOCLHOIJKZCRBB-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |