C23H21NO5 — CID 11349847
ethyl (1'S,3R,5'R,6'S)-2,4'-dioxo-1'-phenylspiro[1H-indole-3,7'-8-oxabicyclo[3.2.1]octane]-6'-carboxylate (PubChem CID 11349847) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is ethyl (1'S,3R,5'R,6'S)-2,4'-dioxo-1'-phenylspiro[1H-indole-3,7'-8-oxabicyclo[3.2.1]octane]-6'-carboxylate.
| Compound Name | ethyl (1'S,3R,5'R,6'S)-2,4'-dioxo-1'-phenylspiro[1H-indole-3,7'-8-oxabicyclo[3.2.1]octane]-6'-carboxylate |
|---|---|
| PubChem CID | 11349847 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | ethyl (1'S,3R,5'R,6'S)-2,4'-dioxo-1'-phenylspiro[1H-indole-3,7'-8-oxabicyclo[3.2.1]octane]-6'-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2O[C@](c3ccccc3)(CCC2=O)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C23H21NO5/c1-2-28-20(26)18-19-17(25)12-13-22(29-19,14-8-4-3-5-9-14)23(18)15-10-6-7-11-16(15)24-21(23)27/h3-11,18-19H,2,12-13H2,1H3,(H,24,27)/t18-,19-,22-,23+/m0/s1 |
| InChIKey | DFTQTJAQRQTISG-DHNNRRLOSA-N |
| XLogP | 2.71 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |