About piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone
piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone (PubChem CID 113498498) has the molecular formula C13H25N3O
and a molecular weight of 239.36 g/mol. Its IUPAC name is piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone |
| PubChem CID | 113498498 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)N2CCCCC2)CC(C)N1C |
| InChI | InChI=1S/C13H25N3O/c1-11-9-16(10-12(2)14(11)3)13(17)15-7-5-4-6-8-15/h11-12H,4-10H2,1-3H3 |
| InChIKey | GWIJLBHIEYRZCB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone?
The IUPAC name of piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone (CID 113498498) is piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone.
What is the SMILES notation for piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone?
The canonical SMILES for piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone is CC1CN(C(=O)N2CCCCC2)CC(C)N1C.
What is the InChIKey of piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone?
The InChIKey is GWIJLBHIEYRZCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O/c1-11-9-16(10-12(2)14(11)3)13(17)15-7-5-4-6-8-15/h11-12H,4-10H2,1-3H3.
What are the key properties of piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone?
piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone has a molecular weight of 239.36 g/mol, XLogP of 1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-yl-(3,4,5-trimethylpiperazin-1-yl)methanone is sourced from PubChem (CID 113498498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).