C12H20N2O2S2 — CID 113498913
2-amino-N-(1-ethylsulfanylpropan-2-yl)-6-methylbenzenesulfonamide (PubChem CID 113498913) has the molecular formula C12H20N2O2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 2-amino-N-(1-ethylsulfanylpropan-2-yl)-6-methylbenzenesulfonamide.
| Compound Name | 2-amino-N-(1-ethylsulfanylpropan-2-yl)-6-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113498913 |
| Molecular Formula | C12H20N2O2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-amino-N-(1-ethylsulfanylpropan-2-yl)-6-methylbenzenesulfonamide |
| SMILES | CCSCC(C)NS(=O)(=O)c1c(C)cccc1N |
| InChI | InChI=1S/C12H20N2O2S2/c1-4-17-8-10(3)14-18(15,16)12-9(2)6-5-7-11(12)13/h5-7,10,14H,4,8,13H2,1-3H3 |
| InChIKey | BVMJBIYCFLKSKT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|