C14H20Br2N2 — CID 113499913
N-[(3,4-dibromophenyl)methyl]-N-propylpyrrolidin-3-amine (PubChem CID 113499913) has the molecular formula C14H20Br2N2 and a molecular weight of 376.14 g/mol. Its IUPAC name is N-[(3,4-dibromophenyl)methyl]-N-propylpyrrolidin-3-amine.
| Compound Name | N-[(3,4-dibromophenyl)methyl]-N-propylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 113499913 |
| Molecular Formula | C14H20Br2N2 |
| Molecular Weight | 376.14 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | N-[(3,4-dibromophenyl)methyl]-N-propylpyrrolidin-3-amine |
| SMILES | CCCN(Cc1ccc(Br)c(Br)c1)C1CCNC1 |
| InChI | InChI=1S/C14H20Br2N2/c1-2-7-18(12-5-6-17-9-12)10-11-3-4-13(15)14(16)8-11/h3-4,8,12,17H,2,5-7,9-10H2,1H3 |
| InChIKey | SUNISCDCNHWTHR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.14 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |