C25H23FN2O2 — CID 11350176
(2S,4R,4'aS)-1'-(4-fluorophenyl)-4'a-methyl-4-phenylspiro[1,3-dioxolane-2,5'-6,7-dihydro-4H-cyclopenta[f]indazole] (PubChem CID 11350176) has the molecular formula C25H23FN2O2 and a molecular weight of 402.47 g/mol. Its IUPAC name is (2S,4R,4'aS)-1'-(4-fluorophenyl)-4'a-methyl-4-phenylspiro[1,3-dioxolane-2,5'-6,7-dihydro-4H-cyclopenta[f]indazole].
| Compound Name | (2S,4R,4'aS)-1'-(4-fluorophenyl)-4'a-methyl-4-phenylspiro[1,3-dioxolane-2,5'-6,7-dihydro-4H-cyclopenta[f]indazole] |
|---|---|
| PubChem CID | 11350176 |
| Molecular Formula | C25H23FN2O2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (2S,4R,4'aS)-1'-(4-fluorophenyl)-4'a-methyl-4-phenylspiro[1,3-dioxolane-2,5'-6,7-dihydro-4H-cyclopenta[f]indazole] |
| SMILES | C[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CC[C@@]21OC[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C25H23FN2O2/c1-24-14-18-15-27-28(21-9-7-20(26)8-10-21)22(18)13-19(24)11-12-25(24)29-16-23(30-25)17-5-3-2-4-6-17/h2-10,13,15,23H,11-12,14,16H2,1H3/t23-,24-,25-/m0/s1 |
| InChIKey | XNIUAXSBXHRMHT-SDHOMARFSA-N |
| XLogP | 5.24 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |