C20H33NO4Si2 — CID 11350315
(3R,4R)-4-[(1S)-1,2-bis(trimethylsilyloxy)ethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one (PubChem CID 11350315) has the molecular formula C20H33NO4Si2 and a molecular weight of 407.66 g/mol. Its IUPAC name is (3R,4R)-4-[(1S)-1,2-bis(trimethylsilyloxy)ethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one.
| Compound Name | (3R,4R)-4-[(1S)-1,2-bis(trimethylsilyloxy)ethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 11350315 |
| Molecular Formula | C20H33NO4Si2 |
| Molecular Weight | 407.66 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (3R,4R)-4-[(1S)-1,2-bis(trimethylsilyloxy)ethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one |
| SMILES | C=CCN1C(=O)[C@H](Oc2ccccc2)[C@@H]1[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H33NO4Si2/c1-8-14-21-18(17(25-27(5,6)7)15-23-26(2,3)4)19(20(21)22)24-16-12-10-9-11-13-16/h8-13,17-19H,1,14-15H2,2-7H3/t17-,18+,19-/m1/s1 |
| InChIKey | DQPKJLIILIJMHL-CEXWTWQISA-N |
| XLogP | 3.90 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|