C26H24N2S2 — CID 11350859
4,5-bis(benzylsulfanyl)-3,6-diethylbenzene-1,2-dicarbonitrile (PubChem CID 11350859) has the molecular formula C26H24N2S2 and a molecular weight of 428.63 g/mol. Its IUPAC name is 4,5-bis(benzylsulfanyl)-3,6-diethylbenzene-1,2-dicarbonitrile.
| Compound Name | 4,5-bis(benzylsulfanyl)-3,6-diethylbenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 11350859 |
| Molecular Formula | C26H24N2S2 |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 4,5-bis(benzylsulfanyl)-3,6-diethylbenzene-1,2-dicarbonitrile |
| SMILES | CCc1c(C#N)c(C#N)c(CC)c(SCc2ccccc2)c1SCc1ccccc1 |
| InChI | InChI=1S/C26H24N2S2/c1-3-21-23(15-27)24(16-28)22(4-2)26(30-18-20-13-9-6-10-14-20)25(21)29-17-19-11-7-5-8-12-19/h5-14H,3-4,17-18H2,1-2H3 |
| InChIKey | QUJIRNTUWGCWIW-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |