C26H38O5 — CID 11350917
6-hydroxy-2-(2-hydroxypropan-2-yl)-5-(3-methylbutanoyl)-3a,7-bis(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-4-one (PubChem CID 11350917) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is 6-hydroxy-2-(2-hydroxypropan-2-yl)-5-(3-methylbutanoyl)-3a,7-bis(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-4-one.
| Compound Name | 6-hydroxy-2-(2-hydroxypropan-2-yl)-5-(3-methylbutanoyl)-3a,7-bis(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-4-one |
|---|---|
| PubChem CID | 11350917 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 6-hydroxy-2-(2-hydroxypropan-2-yl)-5-(3-methylbutanoyl)-3a,7-bis(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-4-one |
| SMILES | CC(C)=CCC1=C2OC(C(C)(C)O)CC2(CC=C(C)C)C(=O)C(C(=O)CC(C)C)=C1O |
| InChI | InChI=1S/C26H38O5/c1-15(2)9-10-18-22(28)21(19(27)13-17(5)6)23(29)26(12-11-16(3)4)14-20(25(7,8)30)31-24(18)26/h9,11,17,20,28,30H,10,12-14H2,1-8H3 |
| InChIKey | UFNSPVPZCKZBHN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|