C20H17BrO6 — CID 11350982
(4-bromophenyl)methyl (1S,9S,10S)-1-methoxy-10-methyl-8-oxo-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-10-carboxylate (PubChem CID 11350982) has the molecular formula C20H17BrO6 and a molecular weight of 433.25 g/mol. Its IUPAC name is (4-bromophenyl)methyl (1S,9S,10S)-1-methoxy-10-methyl-8-oxo-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-10-carboxylate.
| Compound Name | (4-bromophenyl)methyl (1S,9S,10S)-1-methoxy-10-methyl-8-oxo-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-10-carboxylate |
|---|---|
| PubChem CID | 11350982 |
| Molecular Formula | C20H17BrO6 |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | (4-bromophenyl)methyl (1S,9S,10S)-1-methoxy-10-methyl-8-oxo-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-10-carboxylate |
| SMILES | CO[C@]12O[C@H](C(=O)c3ccccc31)[C@@](C)(C(=O)OCc1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C20H17BrO6/c1-19(18(23)25-11-12-7-9-13(21)10-8-12)17-16(22)14-5-3-4-6-15(14)20(24-2,26-17)27-19/h3-10,17H,11H2,1-2H3/t17-,19+,20+/m1/s1 |
| InChIKey | JWXIIDYLIDVCST-HOJAQTOUSA-N |
| XLogP | 3.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |