C27H18N2O4 — CID 11351010
3-(1,3-benzodioxol-5-yl)-2-(3-phenylprop-2-ynoyl)-3,4-dihydro-1H-pyrrolo[3,4-b]quinolin-9-one (PubChem CID 11351010) has the molecular formula C27H18N2O4 and a molecular weight of 434.45 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-(3-phenylprop-2-ynoyl)-3,4-dihydro-1H-pyrrolo[3,4-b]quinolin-9-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2-(3-phenylprop-2-ynoyl)-3,4-dihydro-1H-pyrrolo[3,4-b]quinolin-9-one |
|---|---|
| PubChem CID | 11351010 |
| Molecular Formula | C27H18N2O4 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2-(3-phenylprop-2-ynoyl)-3,4-dihydro-1H-pyrrolo[3,4-b]quinolin-9-one |
| SMILES | O=C(C#Cc1ccccc1)N1Cc2c([nH]c3ccccc3c2=O)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H18N2O4/c30-24(13-10-17-6-2-1-3-7-17)29-15-20-25(28-21-9-5-4-8-19(21)27(20)31)26(29)18-11-12-22-23(14-18)33-16-32-22/h1-9,11-12,14,26H,15-16H2,(H,28,31) |
| InChIKey | QTTGTNNZAWORTH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|