C22H28O4Se — CID 11351040
methyl (E,2S,3R)-3-hydroxy-5-phenyl-2-[[(1S,2S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]selanyl]pent-4-enoate (PubChem CID 11351040) has the molecular formula C22H28O4Se and a molecular weight of 435.42 g/mol. Its IUPAC name is methyl (E,2S,3R)-3-hydroxy-5-phenyl-2-[[(1S,2S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]selanyl]pent-4-enoate.
| Compound Name | methyl (E,2S,3R)-3-hydroxy-5-phenyl-2-[[(1S,2S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]selanyl]pent-4-enoate |
|---|---|
| PubChem CID | 11351040 |
| Molecular Formula | C22H28O4Se |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | methyl (E,2S,3R)-3-hydroxy-5-phenyl-2-[[(1S,2S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]selanyl]pent-4-enoate |
| SMILES | COC(=O)[C@@H]([Se][C@@H]1C(=O)[C@]2(C)CC[C@H]1C2(C)C)[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H28O4Se/c1-21(2)15-12-13-22(21,3)19(24)17(15)27-18(20(25)26-4)16(23)11-10-14-8-6-5-7-9-14/h5-11,15-18,23H,12-13H2,1-4H3/b11-10+/t15-,16-,17+,18+,22+/m1/s1 |
| InChIKey | YRVVYIYYLWDYOR-OOTKOYFFSA-N |
| XLogP | 3.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|