C17H29IO5 — CID 11351160
ethyl (2S)-2-[(2R,5S)-5-[(2R,3S)-3-acetyloxyhexan-2-yl]oxolan-2-yl]-2-iodopropanoate (PubChem CID 11351160) has the molecular formula C17H29IO5 and a molecular weight of 440.32 g/mol. Its IUPAC name is ethyl (2S)-2-[(2R,5S)-5-[(2R,3S)-3-acetyloxyhexan-2-yl]oxolan-2-yl]-2-iodopropanoate.
| Compound Name | ethyl (2S)-2-[(2R,5S)-5-[(2R,3S)-3-acetyloxyhexan-2-yl]oxolan-2-yl]-2-iodopropanoate |
|---|---|
| PubChem CID | 11351160 |
| Molecular Formula | C17H29IO5 |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | ethyl (2S)-2-[(2R,5S)-5-[(2R,3S)-3-acetyloxyhexan-2-yl]oxolan-2-yl]-2-iodopropanoate |
| SMILES | CCC[C@H](OC(C)=O)[C@H](C)[C@@H]1CC[C@H]([C@](C)(I)C(=O)OCC)O1 |
| InChI | InChI=1S/C17H29IO5/c1-6-8-13(22-12(4)19)11(3)14-9-10-15(23-14)17(5,18)16(20)21-7-2/h11,13-15H,6-10H2,1-5H3/t11-,13-,14-,15+,17-/m0/s1 |
| InChIKey | HWKRTSZYYIAKKQ-YIIZKNBGSA-N |
| XLogP | 3.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|