C21H44O2S2Si2 — CID 11351379
tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dithian-2-yl)pent-4-enoxy]-dimethylsilane (PubChem CID 11351379) has the molecular formula C21H44O2S2Si2 and a molecular weight of 448.89 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dithian-2-yl)pent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dithian-2-yl)pent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11351379 |
| Molecular Formula | C21H44O2S2Si2 |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dithian-2-yl)pent-4-enoxy]-dimethylsilane |
| SMILES | C=C[C@@H](C1SCCCS1)[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O2S2Si2/c1-12-17(19-24-14-13-15-25-19)18(23-27(10,11)21(5,6)7)16-22-26(8,9)20(2,3)4/h12,17-19H,1,13-16H2,2-11H3/t17-,18+/m1/s1 |
| InChIKey | QAMJJDSCDMHNSL-MSOLQXFVSA-N |
| XLogP | 7.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|