About 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea
1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea (PubChem CID 11352232) has the molecular formula C24H18ClF2N3O4
and a molecular weight of 485.87 g/mol. Its IUPAC name is 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea |
| PubChem CID | 11352232 |
| Molecular Formula | C24H18ClF2N3O4 |
| Molecular Weight | 485.87 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)Nc4ccc(F)cc4F)c(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C24H18ClF2N3O4/c1-32-22-11-15-20(12-23(22)33-2)28-8-7-21(15)34-14-4-6-18(16(25)10-14)29-24(31)30-19-5-3-13(26)9-17(19)27/h3-12H,1-2H3,(H2,29,30,31) |
| InChIKey | XPTCORXIXMSWEG-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.87 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea?
The IUPAC name of 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea (CID 11352232) is 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea.
What is the SMILES notation for 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea?
The canonical SMILES for 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea is COc1cc2nccc(Oc3ccc(NC(=O)Nc4ccc(F)cc4F)c(Cl)c3)c2cc1OC.
What is the InChIKey of 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea?
The InChIKey is XPTCORXIXMSWEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18ClF2N3O4/c1-32-22-11-15-20(12-23(22)33-2)28-8-7-21(15)34-14-4-6-18(16(25)10-14)29-24(31)30-19-5-3-13(26)9-17(19)27/h3-12H,1-2H3,(H2,29,30,31).
What are the key properties of 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea?
1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea has a molecular weight of 485.87 g/mol, XLogP of 6.62, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea is sourced from PubChem (CID 11352232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).